C17H14F3N3OS — CID 165127934
4-[(1S)-2,2,2-trifluoro-1-phenylethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 165127934) has the molecular formula C17H14F3N3OS and a molecular weight of 365.38 g/mol. Its IUPAC name is 4-[(1S)-2,2,2-trifluoro-1-phenylethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 4-[(1S)-2,2,2-trifluoro-1-phenylethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 165127934 |
| Molecular Formula | C17H14F3N3OS |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 4-[(1S)-2,2,2-trifluoro-1-phenylethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | O=c1c2c3c(sc2ncn1[C@@H](c1ccccc1)C(F)(F)F)CNCC3 |
| InChI | InChI=1S/C17H14F3N3OS/c18-17(19,20)14(10-4-2-1-3-5-10)23-9-22-15-13(16(23)24)11-6-7-21-8-12(11)25-15/h1-5,9,14,21H,6-8H2/t14-/m0/s1 |
| InChIKey | RMLATKOXYCWZLD-AWEZNQCLSA-N |
| XLogP | 3.26 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |