C20H21N5OS — CID 95211347
4-[(1R)-1-(6-methyl-1H-benzimidazol-2-yl)propyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 95211347) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is 4-[(1R)-1-(6-methyl-1H-benzimidazol-2-yl)propyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 4-[(1R)-1-(6-methyl-1H-benzimidazol-2-yl)propyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 95211347 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 4-[(1R)-1-(6-methyl-1H-benzimidazol-2-yl)propyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | CC[C@H](c1nc2ccc(C)cc2[nH]1)n1cnc2sc3c(c2c1=O)CCNC3 |
| InChI | InChI=1S/C20H21N5OS/c1-3-15(18-23-13-5-4-11(2)8-14(13)24-18)25-10-22-19-17(20(25)26)12-6-7-21-9-16(12)27-19/h4-5,8,10,15,21H,3,6-7,9H2,1-2H3,(H,23,24)/t15-/m1/s1 |
| InChIKey | GJVBJJBHOZWBRI-OAHLLOKOSA-N |
| XLogP | 3.29 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |