C17H15F2N3OS — CID 165127948
4-[(1R)-1-(2,4-difluorophenyl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 165127948) has the molecular formula C17H15F2N3OS and a molecular weight of 347.39 g/mol. Its IUPAC name is 4-[(1R)-1-(2,4-difluorophenyl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 4-[(1R)-1-(2,4-difluorophenyl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 165127948 |
| Molecular Formula | C17H15F2N3OS |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 4-[(1R)-1-(2,4-difluorophenyl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | C[C@H](c1ccc(F)cc1F)n1cnc2sc3c(c2c1=O)CCNC3 |
| InChI | InChI=1S/C17H15F2N3OS/c1-9(11-3-2-10(18)6-13(11)19)22-8-21-16-15(17(22)23)12-4-5-20-7-14(12)24-16/h2-3,6,8-9,20H,4-5,7H2,1H3/t9-/m1/s1 |
| InChIKey | PCSJQDAZFCASQF-SECBINFHSA-N |
| XLogP | 2.99 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |