C17H16N6O2S — CID 166274306
4-[2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 166274306) has the molecular formula C17H16N6O2S and a molecular weight of 368.42 g/mol. Its IUPAC name is 4-[2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 4-[2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 166274306 |
| Molecular Formula | C17H16N6O2S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 4-[2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | O=c1c2c3c(sc2ncn1CCn1nc2ccccn2c1=O)CNCC3 |
| InChI | InChI=1S/C17H16N6O2S/c24-16-14-11-4-5-18-9-12(11)26-15(14)19-10-21(16)7-8-23-17(25)22-6-2-1-3-13(22)20-23/h1-3,6,10,18H,4-5,7-9H2 |
| InChIKey | YHCSUFAKRVXZAC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |