C17H12N6OS — CID 122473624
2-[(12-oxo-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-11-yl)methyl]imidazo[1,2-a]pyridine-8-carbonitrile (PubChem CID 122473624) has the molecular formula C17H12N6OS and a molecular weight of 348.39 g/mol. Its IUPAC name is 2-[(12-oxo-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-11-yl)methyl]imidazo[1,2-a]pyridine-8-carbonitrile.
| Compound Name | 2-[(12-oxo-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-11-yl)methyl]imidazo[1,2-a]pyridine-8-carbonitrile |
|---|---|
| PubChem CID | 122473624 |
| Molecular Formula | C17H12N6OS |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-[(12-oxo-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-11-yl)methyl]imidazo[1,2-a]pyridine-8-carbonitrile |
| SMILES | N#Cc1cccn2cc(Cn3cnc4sc5c(c4c3=O)CNC5)nc12 |
| InChI | InChI=1S/C17H12N6OS/c18-4-10-2-1-3-22-7-11(21-15(10)22)8-23-9-20-16-14(17(23)24)12-5-19-6-13(12)25-16/h1-3,7,9,19H,5-6,8H2 |
| InChIKey | DVNQBJKEXVUHLB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 88.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |