C21H24ClN5O — CID 154885877
4-[[2-(2-aminoethyl)quinazolin-4-yl]amino]-1-benzylpyrrolidin-2-one;hydrochloride (PubChem CID 154885877) has the molecular formula C21H24ClN5O and a molecular weight of 397.91 g/mol. Its IUPAC name is 4-[[2-(2-aminoethyl)quinazolin-4-yl]amino]-1-benzylpyrrolidin-2-one;hydrochloride.
| Compound Name | 4-[[2-(2-aminoethyl)quinazolin-4-yl]amino]-1-benzylpyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 154885877 |
| Molecular Formula | C21H24ClN5O |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 4-[[2-(2-aminoethyl)quinazolin-4-yl]amino]-1-benzylpyrrolidin-2-one;hydrochloride |
| SMILES | Cl.NCCc1nc(NC2CC(=O)N(Cc3ccccc3)C2)c2ccccc2n1 |
| InChI | InChI=1S/C21H23N5O.ClH/c22-11-10-19-24-18-9-5-4-8-17(18)21(25-19)23-16-12-20(27)26(14-16)13-15-6-2-1-3-7-15;/h1-9,16H,10-14,22H2,(H,23,24,25);1H |
| InChIKey | YQCOEOUGPVXQOH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |