C18H26Cl2N4O2S — CID 154886219
4-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one;dihydrochloride (PubChem CID 154886219) has the molecular formula C18H26Cl2N4O2S and a molecular weight of 433.41 g/mol. Its IUPAC name is 4-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one;dihydrochloride.
| Compound Name | 4-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one;dihydrochloride |
|---|---|
| PubChem CID | 154886219 |
| Molecular Formula | C18H26Cl2N4O2S |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 4-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one;dihydrochloride |
| SMILES | Cl.Cl.O=c1c2c3c(sc2ncn1[C@H]1COC[C@@H]1N1CCCCC1)CNCC3 |
| InChI | InChI=1S/C18H24N4O2S.2ClH/c23-18-16-12-4-5-19-8-15(12)25-17(16)20-11-22(18)14-10-24-9-13(14)21-6-2-1-3-7-21;;/h11,13-14,19H,1-10H2;2*1H/t13-,14-;;/m0../s1 |
| InChIKey | RJYWIDPLHYDNRA-AXEKQOJOSA-N |
| XLogP | 2.37 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |