C15H18Cl2N6OS — CID 154886848
N-[(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine;dihydrochloride (PubChem CID 154886848) has the molecular formula C15H18Cl2N6OS and a molecular weight of 401.32 g/mol. Its IUPAC name is N-[(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine;dihydrochloride.
| Compound Name | N-[(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 154886848 |
| Molecular Formula | C15H18Cl2N6OS |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N-[(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.c1csc(-c2nc(CNc3ncnc4c3CCNCC4)no2)c1 |
| InChI | InChI=1S/C15H16N6OS.2ClH/c1-2-12(23-7-1)15-20-13(21-22-15)8-17-14-10-3-5-16-6-4-11(10)18-9-19-14;;/h1-2,7,9,16H,3-6,8H2,(H,17,18,19);2*1H |
| InChIKey | UGMADUCJTBNCPK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |