C19H21F3N6O4 — CID 154887533
3-(1,5-dimethyl-1,2,4-triazol-3-yl)-1-[(8-methoxyquinolin-5-yl)methyl]-1-methylurea;2,2,2-trifluoroacetic acid (PubChem CID 154887533) has the molecular formula C19H21F3N6O4 and a molecular weight of 454.41 g/mol. Its IUPAC name is 3-(1,5-dimethyl-1,2,4-triazol-3-yl)-1-[(8-methoxyquinolin-5-yl)methyl]-1-methylurea;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(1,5-dimethyl-1,2,4-triazol-3-yl)-1-[(8-methoxyquinolin-5-yl)methyl]-1-methylurea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154887533 |
| Molecular Formula | C19H21F3N6O4 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 3-(1,5-dimethyl-1,2,4-triazol-3-yl)-1-[(8-methoxyquinolin-5-yl)methyl]-1-methylurea;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CN(C)C(=O)Nc2nc(C)n(C)n2)c2cccnc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H20N6O2.C2HF3O2/c1-11-19-16(21-23(11)3)20-17(24)22(2)10-12-7-8-14(25-4)15-13(12)6-5-9-18-15;3-2(4,5)1(6)7/h5-9H,10H2,1-4H3,(H,20,21,24);(H,6,7) |
| InChIKey | PEZCBNGXRPLKGB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |