C22H24F3N3O3S — CID 154888993
5-[(4,5-dimethylfuran-2-yl)methyl]-3-(phenylsulfanylmethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 154888993) has the molecular formula C22H24F3N3O3S and a molecular weight of 467.51 g/mol. Its IUPAC name is 5-[(4,5-dimethylfuran-2-yl)methyl]-3-(phenylsulfanylmethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[(4,5-dimethylfuran-2-yl)methyl]-3-(phenylsulfanylmethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154888993 |
| Molecular Formula | C22H24F3N3O3S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 5-[(4,5-dimethylfuran-2-yl)methyl]-3-(phenylsulfanylmethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(CN2CCc3[nH]nc(CSc4ccccc4)c3C2)oc1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H23N3OS.C2HF3O2/c1-14-10-16(24-15(14)2)11-23-9-8-19-18(12-23)20(22-21-19)13-25-17-6-4-3-5-7-17;3-2(4,5)1(6)7/h3-7,10H,8-9,11-13H2,1-2H3,(H,21,22);(H,6,7) |
| InChIKey | KEJMQPDRBZKJEK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 82.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |