C9H16O5S — CID 15489181
(2S,3aR,6R,7S,7aR)-2-ethylsulfanyl-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol (PubChem CID 15489181) has the molecular formula C9H16O5S and a molecular weight of 236.29 g/mol. Its IUPAC name is (2S,3aR,6R,7S,7aR)-2-ethylsulfanyl-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol.
| Compound Name | (2S,3aR,6R,7S,7aR)-2-ethylsulfanyl-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol |
|---|---|
| PubChem CID | 15489181 |
| Molecular Formula | C9H16O5S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | (2S,3aR,6R,7S,7aR)-2-ethylsulfanyl-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol |
| SMILES | CCS[C@]1(C)O[C@H]2OC[C@@H](O)[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C9H16O5S/c1-3-15-9(2)13-7-6(11)5(10)4-12-8(7)14-9/h5-8,10-11H,3-4H2,1-2H3/t5-,6+,7-,8-,9+/m1/s1 |
| InChIKey | SLANBXOMBYMJEO-WUNNTHRKSA-N |
| XLogP | -0.09 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |