C23H27F3N2O4 — CID 154891873
6-ethyl-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)-2-methylquinoline-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 154891873) has the molecular formula C23H27F3N2O4 and a molecular weight of 452.47 g/mol. Its IUPAC name is 6-ethyl-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)-2-methylquinoline-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 6-ethyl-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)-2-methylquinoline-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154891873 |
| Molecular Formula | C23H27F3N2O4 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 6-ethyl-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)-2-methylquinoline-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | C=CCC(O)(CC=C)CNC(=O)c1cc(C)nc2ccc(CC)cc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H26N2O2.C2HF3O2/c1-5-10-21(25,11-6-2)14-22-20(24)18-12-15(4)23-19-9-8-16(7-3)13-17(18)19;3-2(4,5)1(6)7/h5-6,8-9,12-13,25H,1-2,7,10-11,14H2,3-4H3,(H,22,24);(H,6,7) |
| InChIKey | HTHONXYQUJMQPX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|