C22H23Cl2N3O — CID 154894486
4-[4-(2-chlorophenyl)piperidin-4-yl]-2-(phenoxymethyl)pyrimidine;hydrochloride (PubChem CID 154894486) has the molecular formula C22H23Cl2N3O and a molecular weight of 416.35 g/mol. Its IUPAC name is 4-[4-(2-chlorophenyl)piperidin-4-yl]-2-(phenoxymethyl)pyrimidine;hydrochloride.
| Compound Name | 4-[4-(2-chlorophenyl)piperidin-4-yl]-2-(phenoxymethyl)pyrimidine;hydrochloride |
|---|---|
| PubChem CID | 154894486 |
| Molecular Formula | C22H23Cl2N3O |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 4-[4-(2-chlorophenyl)piperidin-4-yl]-2-(phenoxymethyl)pyrimidine;hydrochloride |
| SMILES | Cl.Clc1ccccc1C1(c2ccnc(COc3ccccc3)n2)CCNCC1 |
| InChI | InChI=1S/C22H22ClN3O.ClH/c23-19-9-5-4-8-18(19)22(11-14-24-15-12-22)20-10-13-25-21(26-20)16-27-17-6-2-1-3-7-17;/h1-10,13,24H,11-12,14-16H2;1H |
| InChIKey | RHOPWKHREUQUOH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |