C18H23Cl2N3O — CID 154894507
4-[4-(2-chlorophenyl)piperidin-4-yl]-2-(ethoxymethyl)pyrimidine;hydrochloride (PubChem CID 154894507) has the molecular formula C18H23Cl2N3O and a molecular weight of 368.31 g/mol. Its IUPAC name is 4-[4-(2-chlorophenyl)piperidin-4-yl]-2-(ethoxymethyl)pyrimidine;hydrochloride.
| Compound Name | 4-[4-(2-chlorophenyl)piperidin-4-yl]-2-(ethoxymethyl)pyrimidine;hydrochloride |
|---|---|
| PubChem CID | 154894507 |
| Molecular Formula | C18H23Cl2N3O |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 4-[4-(2-chlorophenyl)piperidin-4-yl]-2-(ethoxymethyl)pyrimidine;hydrochloride |
| SMILES | CCOCc1nccc(C2(c3ccccc3Cl)CCNCC2)n1.Cl |
| InChI | InChI=1S/C18H22ClN3O.ClH/c1-2-23-13-17-21-10-7-16(22-17)18(8-11-20-12-9-18)14-5-3-4-6-15(14)19;/h3-7,10,20H,2,8-9,11-13H2,1H3;1H |
| InChIKey | PGMPIHDCPWFONV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |