C14H23Cl3N2OS — CID 154897278
3-[[2-[(3-chlorophenyl)methylsulfanyl]ethylamino]methyl]pyrrolidin-3-ol;dihydrochloride (PubChem CID 154897278) has the molecular formula C14H23Cl3N2OS and a molecular weight of 373.78 g/mol. Its IUPAC name is 3-[[2-[(3-chlorophenyl)methylsulfanyl]ethylamino]methyl]pyrrolidin-3-ol;dihydrochloride.
| Compound Name | 3-[[2-[(3-chlorophenyl)methylsulfanyl]ethylamino]methyl]pyrrolidin-3-ol;dihydrochloride |
|---|---|
| PubChem CID | 154897278 |
| Molecular Formula | C14H23Cl3N2OS |
| Molecular Weight | 373.78 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 3-[[2-[(3-chlorophenyl)methylsulfanyl]ethylamino]methyl]pyrrolidin-3-ol;dihydrochloride |
| SMILES | Cl.Cl.OC1(CNCCSCc2cccc(Cl)c2)CCNC1 |
| InChI | InChI=1S/C14H21ClN2OS.2ClH/c15-13-3-1-2-12(8-13)9-19-7-6-17-11-14(18)4-5-16-10-14;;/h1-3,8,16-18H,4-7,9-11H2;2*1H |
| InChIKey | QOHUHUHCJRAYRD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.78 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|