About 5-[3-[2-(1-piperidin-4-yltriazol-4-yl)imidazol-1-yl]phenyl]-1,3-oxazole;hydrochloride
5-[3-[2-(1-piperidin-4-yltriazol-4-yl)imidazol-1-yl]phenyl]-1,3-oxazole;hydrochloride (PubChem CID 154898642) has the molecular formula C19H20ClN7O
and a molecular weight of 397.87 g/mol. Its IUPAC name is 5-[3-[2-(1-piperidin-4-yltriazol-4-yl)imidazol-1-yl]phenyl]-1,3-oxazole;hydrochloride.
Molecular Properties
| Compound Name | 5-[3-[2-(1-piperidin-4-yltriazol-4-yl)imidazol-1-yl]phenyl]-1,3-oxazole;hydrochloride |
| PubChem CID | 154898642 |
| Molecular Formula | C19H20ClN7O |
| Molecular Weight | 397.87 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 5-[3-[2-(1-piperidin-4-yltriazol-4-yl)imidazol-1-yl]phenyl]-1,3-oxazole;hydrochloride |
| SMILES | Cl.c1cc(-c2cnco2)cc(-n2ccnc2-c2cn(C3CCNCC3)nn2)c1 |
| InChI | InChI=1S/C19H19N7O.ClH/c1-2-14(18-11-21-13-27-18)10-16(3-1)25-9-8-22-19(25)17-12-26(24-23-17)15-4-6-20-7-5-15;/h1-3,8-13,15,20H,4-7H2;1H |
| InChIKey | NOSAAIVEMIBZSW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.87 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-[3-[2-(1-piperidin-4-yltriazol-4-yl)imidazol-1-yl]phenyl]-1,3-oxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[2-(1-piperidin-4-yltriazol-4-yl)imidazol-1-yl]phenyl]-1,3-oxazole;hydrochloride?
The IUPAC name of 5-[3-[2-(1-piperidin-4-yltriazol-4-yl)imidazol-1-yl]phenyl]-1,3-oxazole;hydrochloride (CID 154898642) is 5-[3-[2-(1-piperidin-4-yltriazol-4-yl)imidazol-1-yl]phenyl]-1,3-oxazole;hydrochloride.
What is the SMILES notation for 5-[3-[2-(1-piperidin-4-yltriazol-4-yl)imidazol-1-yl]phenyl]-1,3-oxazole;hydrochloride?
The canonical SMILES for 5-[3-[2-(1-piperidin-4-yltriazol-4-yl)imidazol-1-yl]phenyl]-1,3-oxazole;hydrochloride is Cl.c1cc(-c2cnco2)cc(-n2ccnc2-c2cn(C3CCNCC3)nn2)c1.
What is the InChIKey of 5-[3-[2-(1-piperidin-4-yltriazol-4-yl)imidazol-1-yl]phenyl]-1,3-oxazole;hydrochloride?
The InChIKey is NOSAAIVEMIBZSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N7O.ClH/c1-2-14(18-11-21-13-27-18)10-16(3-1)25-9-8-22-19(25)17-12-26(24-23-17)15-4-6-20-7-5-15;/h1-3,8-13,15,20H,4-7H2;1H.
What are the key properties of 5-[3-[2-(1-piperidin-4-yltriazol-4-yl)imidazol-1-yl]phenyl]-1,3-oxazole;hydrochloride?
5-[3-[2-(1-piperidin-4-yltriazol-4-yl)imidazol-1-yl]phenyl]-1,3-oxazole;hydrochloride has a molecular weight of 397.87 g/mol, XLogP of 3.13, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[2-(1-piperidin-4-yltriazol-4-yl)imidazol-1-yl]phenyl]-1,3-oxazole;hydrochloride is sourced from PubChem (CID 154898642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).