C13H20ClN5O — CID 154898801
[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[2-(ethylamino)pyrimidin-5-yl]methanone;hydrochloride (PubChem CID 154898801) has the molecular formula C13H20ClN5O and a molecular weight of 297.79 g/mol. Its IUPAC name is [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[2-(ethylamino)pyrimidin-5-yl]methanone;hydrochloride.
| Compound Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[2-(ethylamino)pyrimidin-5-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 154898801 |
| Molecular Formula | C13H20ClN5O |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-[2-(ethylamino)pyrimidin-5-yl]methanone;hydrochloride |
| SMILES | CCNc1ncc(C(=O)N2CC[C@H]3CNC[C@H]32)cn1.Cl |
| InChI | InChI=1S/C13H19N5O.ClH/c1-2-15-13-16-6-10(7-17-13)12(19)18-4-3-9-5-14-8-11(9)18;/h6-7,9,11,14H,2-5,8H2,1H3,(H,15,16,17);1H/t9-,11+;/m0./s1 |
| InChIKey | FRFVUWZJQXADAM-QLSWKGBWSA-N |
| XLogP | 0.76 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |