C17H23ClN4O3S — CID 154901633
9-methoxy-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-7-oxo-2,3,4,5-tetrahydro-1H-pyrido[1,2-d][1,4]diazepine-10-carboxamide;hydrochloride (PubChem CID 154901633) has the molecular formula C17H23ClN4O3S and a molecular weight of 398.92 g/mol. Its IUPAC name is 9-methoxy-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-7-oxo-2,3,4,5-tetrahydro-1H-pyrido[1,2-d][1,4]diazepine-10-carboxamide;hydrochloride.
| Compound Name | 9-methoxy-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-7-oxo-2,3,4,5-tetrahydro-1H-pyrido[1,2-d][1,4]diazepine-10-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 154901633 |
| Molecular Formula | C17H23ClN4O3S |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 9-methoxy-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-7-oxo-2,3,4,5-tetrahydro-1H-pyrido[1,2-d][1,4]diazepine-10-carboxamide;hydrochloride |
| SMILES | COc1cc(=O)n2c(c1C(=O)NCCc1scnc1C)CCNCC2.Cl |
| InChI | InChI=1S/C17H22N4O3S.ClH/c1-11-14(25-10-20-11)4-6-19-17(23)16-12-3-5-18-7-8-21(12)15(22)9-13(16)24-2;/h9-10,18H,3-8H2,1-2H3,(H,19,23);1H |
| InChIKey | FKOCJQUADWRABO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |