C21H32Cl2N6O — CID 154901742
4-(3-aminocyclobutyl)-6-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidin-2-amine;dihydrochloride (PubChem CID 154901742) has the molecular formula C21H32Cl2N6O and a molecular weight of 455.43 g/mol. Its IUPAC name is 4-(3-aminocyclobutyl)-6-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidin-2-amine;dihydrochloride.
| Compound Name | 4-(3-aminocyclobutyl)-6-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 154901742 |
| Molecular Formula | C21H32Cl2N6O |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 4-(3-aminocyclobutyl)-6-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidin-2-amine;dihydrochloride |
| SMILES | COc1ccc(N2CCN(c3cc(C4CC(N)C4)nc(N)n3)CC2(C)C)cc1.Cl.Cl |
| InChI | InChI=1S/C21H30N6O.2ClH/c1-21(2)13-26(8-9-27(21)16-4-6-17(28-3)7-5-16)19-12-18(24-20(23)25-19)14-10-15(22)11-14;;/h4-7,12,14-15H,8-11,13,22H2,1-3H3,(H2,23,24,25);2*1H |
| InChIKey | XQYVAPWSZWEALF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|