C17H25Cl2N3O — CID 154904579
1-[4-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]methyl]phenyl]pyrrolidin-2-one;dihydrochloride (PubChem CID 154904579) has the molecular formula C17H25Cl2N3O and a molecular weight of 358.31 g/mol. Its IUPAC name is 1-[4-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]methyl]phenyl]pyrrolidin-2-one;dihydrochloride.
| Compound Name | 1-[4-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]methyl]phenyl]pyrrolidin-2-one;dihydrochloride |
|---|---|
| PubChem CID | 154904579 |
| Molecular Formula | C17H25Cl2N3O |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 1-[4-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]methyl]phenyl]pyrrolidin-2-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1CCCN1c1ccc(CN2CC[C@H]3CNC[C@H]32)cc1 |
| InChI | InChI=1S/C17H23N3O.2ClH/c21-17-2-1-8-20(17)15-5-3-13(4-6-15)12-19-9-7-14-10-18-11-16(14)19;;/h3-6,14,16,18H,1-2,7-12H2;2*1H/t14-,16+;;/m0../s1 |
| InChIKey | OWPMEZLBJPUCPX-HSAGCVDLSA-N |
| XLogP | 2.45 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |