C16H25N5 — CID 156608413
1-[(2-piperidin-1-ylpyrimidin-5-yl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 156608413) has the molecular formula C16H25N5 and a molecular weight of 287.41 g/mol. Its IUPAC name is 1-[(2-piperidin-1-ylpyrimidin-5-yl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | 1-[(2-piperidin-1-ylpyrimidin-5-yl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 156608413 |
| Molecular Formula | C16H25N5 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | 1-[(2-piperidin-1-ylpyrimidin-5-yl)methyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | c1nc(N2CCCCC2)ncc1CN1CCC2CNCC21 |
| InChI | InChI=1S/C16H25N5/c1-2-5-20(6-3-1)16-18-8-13(9-19-16)12-21-7-4-14-10-17-11-15(14)21/h8-9,14-15,17H,1-7,10-12H2 |
| InChIKey | BXDMKLSMMHYZRU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |