C17H27N5 — CID 167837599
(4aS,7aS)-6-methyl-1-[(2-pyrrolidin-1-ylpyrimidin-5-yl)methyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine (PubChem CID 167837599) has the molecular formula C17H27N5 and a molecular weight of 301.44 g/mol. Its IUPAC name is (4aS,7aS)-6-methyl-1-[(2-pyrrolidin-1-ylpyrimidin-5-yl)methyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine.
| Compound Name | (4aS,7aS)-6-methyl-1-[(2-pyrrolidin-1-ylpyrimidin-5-yl)methyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 167837599 |
| Molecular Formula | C17H27N5 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | (4aS,7aS)-6-methyl-1-[(2-pyrrolidin-1-ylpyrimidin-5-yl)methyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
| SMILES | CN1C[C@@H]2CCCN(Cc3cnc(N4CCCC4)nc3)[C@@H]2C1 |
| InChI | InChI=1S/C17H27N5/c1-20-12-15-5-4-8-22(16(15)13-20)11-14-9-18-17(19-10-14)21-6-2-3-7-21/h9-10,15-16H,2-8,11-13H2,1H3/t15-,16+/m0/s1 |
| InChIKey | ZNZSWQNDDCGYRH-JKSUJKDBSA-N |
| XLogP | 1.60 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |