C19H26N4O3S — CID 154908373
3-(dimethylamino)-N-[[2-(3-methylphenyl)-1,3-thiazol-4-yl]methyl]pyrrolidine-1-carboxamide;formic acid (PubChem CID 154908373) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[[2-(3-methylphenyl)-1,3-thiazol-4-yl]methyl]pyrrolidine-1-carboxamide;formic acid.
| Compound Name | 3-(dimethylamino)-N-[[2-(3-methylphenyl)-1,3-thiazol-4-yl]methyl]pyrrolidine-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 154908373 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 3-(dimethylamino)-N-[[2-(3-methylphenyl)-1,3-thiazol-4-yl]methyl]pyrrolidine-1-carboxamide;formic acid |
| SMILES | Cc1cccc(-c2nc(CNC(=O)N3CCC(N(C)C)C3)cs2)c1.O=CO |
| InChI | InChI=1S/C18H24N4OS.CH2O2/c1-13-5-4-6-14(9-13)17-20-15(12-24-17)10-19-18(23)22-8-7-16(11-22)21(2)3;2-1-3/h4-6,9,12,16H,7-8,10-11H2,1-3H3,(H,19,23);1H,(H,2,3) |
| InChIKey | AHHLRKAEAPIEAE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|