C15H19F4N3O2 — CID 154908586
formic acid;4,4,4-trifluoro-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]butan-2-amine (PubChem CID 154908586) has the molecular formula C15H19F4N3O2 and a molecular weight of 349.33 g/mol. Its IUPAC name is formic acid;4,4,4-trifluoro-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]butan-2-amine.
| Compound Name | formic acid;4,4,4-trifluoro-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]butan-2-amine |
|---|---|
| PubChem CID | 154908586 |
| Molecular Formula | C15H19F4N3O2 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | formic acid;4,4,4-trifluoro-N-[3-(6-fluoro-1H-benzimidazol-2-yl)propyl]butan-2-amine |
| SMILES | CC(CC(F)(F)F)NCCCc1nc2ccc(F)cc2[nH]1.O=CO |
| InChI | InChI=1S/C14H17F4N3.CH2O2/c1-9(8-14(16,17)18)19-6-2-3-13-20-11-5-4-10(15)7-12(11)21-13;2-1-3/h4-5,7,9,19H,2-3,6,8H2,1H3,(H,20,21);1H,(H,2,3) |
| InChIKey | DCICTYNMTXCRCE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|