C17H27N5O5 — CID 154908973
formic acid;1-[2-[[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)amino]methyl]morpholin-4-yl]ethanone (PubChem CID 154908973) has the molecular formula C17H27N5O5 and a molecular weight of 381.43 g/mol. Its IUPAC name is formic acid;1-[2-[[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)amino]methyl]morpholin-4-yl]ethanone.
| Compound Name | formic acid;1-[2-[[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)amino]methyl]morpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 154908973 |
| Molecular Formula | C17H27N5O5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | formic acid;1-[2-[[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)amino]methyl]morpholin-4-yl]ethanone |
| SMILES | CC(=O)N1CCOC(CNc2cc(C)nc(N3CCOCC3)n2)C1.O=CO |
| InChI | InChI=1S/C16H25N5O3.CH2O2/c1-12-9-15(19-16(18-12)20-3-6-23-7-4-20)17-10-14-11-21(13(2)22)5-8-24-14;2-1-3/h9,14H,3-8,10-11H2,1-2H3,(H,17,18,19);1H,(H,2,3) |
| InChIKey | ANJGZSOOLHVJHI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|