C24H34N4O5 — CID 15490931
1-hydroxy-3-[4-[4-[[hydroxy(pentan-3-yl)carbamoyl]amino]phenoxy]phenyl]-1-pentan-3-ylurea (PubChem CID 15490931) has the molecular formula C24H34N4O5 and a molecular weight of 458.56 g/mol. Its IUPAC name is 1-hydroxy-3-[4-[4-[[hydroxy(pentan-3-yl)carbamoyl]amino]phenoxy]phenyl]-1-pentan-3-ylurea.
| Compound Name | 1-hydroxy-3-[4-[4-[[hydroxy(pentan-3-yl)carbamoyl]amino]phenoxy]phenyl]-1-pentan-3-ylurea |
|---|---|
| PubChem CID | 15490931 |
| Molecular Formula | C24H34N4O5 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 1-hydroxy-3-[4-[4-[[hydroxy(pentan-3-yl)carbamoyl]amino]phenoxy]phenyl]-1-pentan-3-ylurea |
| SMILES | CCC(CC)N(O)C(=O)Nc1ccc(Oc2ccc(NC(=O)N(O)C(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C24H34N4O5/c1-5-19(6-2)27(31)23(29)25-17-9-13-21(14-10-17)33-22-15-11-18(12-16-22)26-24(30)28(32)20(7-3)8-4/h9-16,19-20,31-32H,5-8H2,1-4H3,(H,25,29)(H,26,30) |
| InChIKey | BWOHDKYYDSDFRM-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|