C21H27N7O3 — CID 154911676
1-(4-aminocyclohexyl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]triazole-4-carboxamide;formic acid (PubChem CID 154911676) has the molecular formula C21H27N7O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is 1-(4-aminocyclohexyl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]triazole-4-carboxamide;formic acid.
| Compound Name | 1-(4-aminocyclohexyl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]triazole-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 154911676 |
| Molecular Formula | C21H27N7O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 1-(4-aminocyclohexyl)-N-[2-(1-phenylpyrazol-4-yl)ethyl]triazole-4-carboxamide;formic acid |
| SMILES | NC1CCC(n2cc(C(=O)NCCc3cnn(-c4ccccc4)c3)nn2)CC1.O=CO |
| InChI | InChI=1S/C20H25N7O.CH2O2/c21-16-6-8-18(9-7-16)27-14-19(24-25-27)20(28)22-11-10-15-12-23-26(13-15)17-4-2-1-3-5-17;2-1-3/h1-5,12-14,16,18H,6-11,21H2,(H,22,28);1H,(H,2,3) |
| InChIKey | LWOOIVWAXUAUIR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 140.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|