C20H31N5O4 — CID 154911901
1-[1-[2-ethyl-5-[(2-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]ethyl]-4-methylpiperazine;formic acid (PubChem CID 154911901) has the molecular formula C20H31N5O4 and a molecular weight of 405.50 g/mol. Its IUPAC name is 1-[1-[2-ethyl-5-[(2-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]ethyl]-4-methylpiperazine;formic acid.
| Compound Name | 1-[1-[2-ethyl-5-[(2-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]ethyl]-4-methylpiperazine;formic acid |
|---|---|
| PubChem CID | 154911901 |
| Molecular Formula | C20H31N5O4 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 1-[1-[2-ethyl-5-[(2-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]ethyl]-4-methylpiperazine;formic acid |
| SMILES | CCn1nc(COc2ccccc2OC)nc1C(C)N1CCN(C)CC1.O=CO |
| InChI | InChI=1S/C19H29N5O2.CH2O2/c1-5-24-19(15(2)23-12-10-22(3)11-13-23)20-18(21-24)14-26-17-9-7-6-8-16(17)25-4;2-1-3/h6-9,15H,5,10-14H2,1-4H3;1H,(H,2,3) |
| InChIKey | HXUHJXSQIZHDNQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|