C21H27N3O5 — CID 154911998
formic acid;2-[4-(2,3,4,9-tetrahydro-1H-carbazole-1-carbonylamino)piperidin-1-yl]acetic acid (PubChem CID 154911998) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is formic acid;2-[4-(2,3,4,9-tetrahydro-1H-carbazole-1-carbonylamino)piperidin-1-yl]acetic acid.
| Compound Name | formic acid;2-[4-(2,3,4,9-tetrahydro-1H-carbazole-1-carbonylamino)piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 154911998 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | formic acid;2-[4-(2,3,4,9-tetrahydro-1H-carbazole-1-carbonylamino)piperidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCC(NC(=O)C2CCCc3c2[nH]c2ccccc32)CC1.O=CO |
| InChI | InChI=1S/C20H25N3O3.CH2O2/c24-18(25)12-23-10-8-13(9-11-23)21-20(26)16-6-3-5-15-14-4-1-2-7-17(14)22-19(15)16;2-1-3/h1-2,4,7,13,16,22H,3,5-6,8-12H2,(H,21,26)(H,24,25);1H,(H,2,3) |
| InChIKey | AFGLOFAIKFOTTG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|