C15H28N2O5 — CID 154912705
N-[[1-(2,3-dihydroxypropyl)piperidin-4-yl]methyl]cyclobutanecarboxamide;formic acid (PubChem CID 154912705) has the molecular formula C15H28N2O5 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[[1-(2,3-dihydroxypropyl)piperidin-4-yl]methyl]cyclobutanecarboxamide;formic acid.
| Compound Name | N-[[1-(2,3-dihydroxypropyl)piperidin-4-yl]methyl]cyclobutanecarboxamide;formic acid |
|---|---|
| PubChem CID | 154912705 |
| Molecular Formula | C15H28N2O5 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | N-[[1-(2,3-dihydroxypropyl)piperidin-4-yl]methyl]cyclobutanecarboxamide;formic acid |
| SMILES | O=C(NCC1CCN(CC(O)CO)CC1)C1CCC1.O=CO |
| InChI | InChI=1S/C14H26N2O3.CH2O2/c17-10-13(18)9-16-6-4-11(5-7-16)8-15-14(19)12-2-1-3-12;2-1-3/h11-13,17-18H,1-10H2,(H,15,19);1H,(H,2,3) |
| InChIKey | NAPJXIVIIZUZIO-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|