C18H26N4O3 — CID 154913533
formic acid;1-[[5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]methyl]azepane (PubChem CID 154913533) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is formic acid;1-[[5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]methyl]azepane.
| Compound Name | formic acid;1-[[5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]methyl]azepane |
|---|---|
| PubChem CID | 154913533 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | formic acid;1-[[5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]methyl]azepane |
| SMILES | COc1ccccc1Cc1nc(CN2CCCCCC2)n[nH]1.O=CO |
| InChI | InChI=1S/C17H24N4O.CH2O2/c1-22-15-9-5-4-8-14(15)12-16-18-17(20-19-16)13-21-10-6-2-3-7-11-21;2-1-3/h4-5,8-9H,2-3,6-7,10-13H2,1H3,(H,18,19,20);1H,(H,2,3) |
| InChIKey | SGRQPRZSXPGCBZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|