C17H26N2O4S — CID 154914261
2-[[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-methylamino]-N-(thiophen-2-ylmethyl)acetamide;formic acid (PubChem CID 154914261) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is 2-[[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-methylamino]-N-(thiophen-2-ylmethyl)acetamide;formic acid.
| Compound Name | 2-[[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-methylamino]-N-(thiophen-2-ylmethyl)acetamide;formic acid |
|---|---|
| PubChem CID | 154914261 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-[[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-methylamino]-N-(thiophen-2-ylmethyl)acetamide;formic acid |
| SMILES | CN(CC(=O)NCc1cccs1)C1C[C@H]2CC(O)C[C@H]2C1.O=CO |
| InChI | InChI=1S/C16H24N2O2S.CH2O2/c1-18(10-16(20)17-9-15-3-2-4-21-15)13-5-11-7-14(19)8-12(11)6-13;2-1-3/h2-4,11-14,19H,5-10H2,1H3,(H,17,20);1H,(H,2,3)/t11-,12+,13?,14?; |
| InChIKey | FDWAIKLTZVHJGN-VLPUPSJZSA-N |
| XLogP | 1.55 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|