C23H36N2O6 — CID 154915626
(3aR,6aS)-2-N,2-N,5-N-trimethyl-5-N-[(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine;formic acid (PubChem CID 154915626) has the molecular formula C23H36N2O6 and a molecular weight of 436.55 g/mol. Its IUPAC name is (3aR,6aS)-2-N,2-N,5-N-trimethyl-5-N-[(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine;formic acid.
| Compound Name | (3aR,6aS)-2-N,2-N,5-N-trimethyl-5-N-[(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine;formic acid |
|---|---|
| PubChem CID | 154915626 |
| Molecular Formula | C23H36N2O6 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | (3aR,6aS)-2-N,2-N,5-N-trimethyl-5-N-[(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine;formic acid |
| SMILES | Cc1cc2c(cc1CN(C)C1C[C@H]3CC(N(C)C)C[C@H]3C1)OCCO2.O=CO.O=CO |
| InChI | InChI=1S/C21H32N2O2.2CH2O2/c1-14-7-20-21(25-6-5-24-20)12-17(14)13-23(4)19-10-15-8-18(22(2)3)9-16(15)11-19;2*2-1-3/h7,12,15-16,18-19H,5-6,8-11,13H2,1-4H3;2*1H,(H,2,3)/t15-,16+,18?,19?;; |
| InChIKey | IEVCCXCTCULQPN-VABVRSNPSA-N |
| XLogP | 2.72 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|