C20H32N2 — CID 135099440
(3aR,6aS)-5-N-[(2,3-dimethylphenyl)methyl]-2-N,2-N,5-N-trimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine (PubChem CID 135099440) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is (3aR,6aS)-5-N-[(2,3-dimethylphenyl)methyl]-2-N,2-N,5-N-trimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine.
| Compound Name | (3aR,6aS)-5-N-[(2,3-dimethylphenyl)methyl]-2-N,2-N,5-N-trimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine |
|---|---|
| PubChem CID | 135099440 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | (3aR,6aS)-5-N-[(2,3-dimethylphenyl)methyl]-2-N,2-N,5-N-trimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine |
| SMILES | Cc1cccc(CN(C)C2C[C@H]3CC(N(C)C)C[C@H]3C2)c1C |
| InChI | InChI=1S/C20H32N2/c1-14-7-6-8-16(15(14)2)13-22(5)20-11-17-9-19(21(3)4)10-18(17)12-20/h6-8,17-20H,9-13H2,1-5H3/t17-,18+,19?,20? |
| InChIKey | NTHAXGLSTZMBME-VCWRXUFXSA-N |
| XLogP | 3.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |