C19H28F2N2 — CID 135108043
(3aS,6aR)-5-N-[(2,3-difluoro-4-methylphenyl)methyl]-2-N,2-N,5-N-trimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine (PubChem CID 135108043) has the molecular formula C19H28F2N2 and a molecular weight of 322.44 g/mol. Its IUPAC name is (3aS,6aR)-5-N-[(2,3-difluoro-4-methylphenyl)methyl]-2-N,2-N,5-N-trimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine.
| Compound Name | (3aS,6aR)-5-N-[(2,3-difluoro-4-methylphenyl)methyl]-2-N,2-N,5-N-trimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine |
|---|---|
| PubChem CID | 135108043 |
| Molecular Formula | C19H28F2N2 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | (3aS,6aR)-5-N-[(2,3-difluoro-4-methylphenyl)methyl]-2-N,2-N,5-N-trimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine |
| SMILES | Cc1ccc(CN(C)C2C[C@H]3CC(N(C)C)C[C@H]3C2)c(F)c1F |
| InChI | InChI=1S/C19H28F2N2/c1-12-5-6-13(19(21)18(12)20)11-23(4)17-9-14-7-16(22(2)3)8-15(14)10-17/h5-6,14-17H,7-11H2,1-4H3/t14-,15+,16?,17? |
| InChIKey | ZRLAZHKUXXTGKS-RYTJFDOTSA-N |
| XLogP | 3.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |