C21H28ClN3O — CID 135109757
3-[[[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-methylamino]methyl]-7-chloro-1H-quinolin-2-one (PubChem CID 135109757) has the molecular formula C21H28ClN3O and a molecular weight of 373.93 g/mol. Its IUPAC name is 3-[[[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-methylamino]methyl]-7-chloro-1H-quinolin-2-one.
| Compound Name | 3-[[[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-methylamino]methyl]-7-chloro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 135109757 |
| Molecular Formula | C21H28ClN3O |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 3-[[[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-methylamino]methyl]-7-chloro-1H-quinolin-2-one |
| SMILES | CN(C)C1C[C@@H]2CC(N(C)Cc3cc4ccc(Cl)cc4[nH]c3=O)C[C@@H]2C1 |
| InChI | InChI=1S/C21H28ClN3O/c1-24(2)18-7-14-9-19(10-15(14)8-18)25(3)12-16-6-13-4-5-17(22)11-20(13)23-21(16)26/h4-6,11,14-15,18-19H,7-10,12H2,1-3H3,(H,23,26)/t14-,15+,18?,19? |
| InChIKey | YIULBHTVFGNOEN-MYMYQCDVSA-N |
| XLogP | 3.73 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |