C17H22ClN3O — CID 95388340
7-chloro-3-[[methyl-[[(2S)-1-methylpyrrolidin-2-yl]methyl]amino]methyl]-1H-quinolin-2-one (PubChem CID 95388340) has the molecular formula C17H22ClN3O and a molecular weight of 319.84 g/mol. Its IUPAC name is 7-chloro-3-[[methyl-[[(2S)-1-methylpyrrolidin-2-yl]methyl]amino]methyl]-1H-quinolin-2-one.
| Compound Name | 7-chloro-3-[[methyl-[[(2S)-1-methylpyrrolidin-2-yl]methyl]amino]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 95388340 |
| Molecular Formula | C17H22ClN3O |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 7-chloro-3-[[methyl-[[(2S)-1-methylpyrrolidin-2-yl]methyl]amino]methyl]-1H-quinolin-2-one |
| SMILES | CN(Cc1cc2ccc(Cl)cc2[nH]c1=O)C[C@@H]1CCCN1C |
| InChI | InChI=1S/C17H22ClN3O/c1-20(11-15-4-3-7-21(15)2)10-13-8-12-5-6-14(18)9-16(12)19-17(13)22/h5-6,8-9,15H,3-4,7,10-11H2,1-2H3,(H,19,22)/t15-/m0/s1 |
| InChIKey | RRCOOHQNMHQTAY-HNNXBMFYSA-N |
| XLogP | 2.71 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |