C18H23ClN2O2 — CID 95197872
7-chloro-3-[[4-[(1R)-1-hydroxypropyl]piperidin-1-yl]methyl]-1H-quinolin-2-one (PubChem CID 95197872) has the molecular formula C18H23ClN2O2 and a molecular weight of 334.85 g/mol. Its IUPAC name is 7-chloro-3-[[4-[(1R)-1-hydroxypropyl]piperidin-1-yl]methyl]-1H-quinolin-2-one.
| Compound Name | 7-chloro-3-[[4-[(1R)-1-hydroxypropyl]piperidin-1-yl]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 95197872 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 7-chloro-3-[[4-[(1R)-1-hydroxypropyl]piperidin-1-yl]methyl]-1H-quinolin-2-one |
| SMILES | CC[C@@H](O)C1CCN(Cc2cc3ccc(Cl)cc3[nH]c2=O)CC1 |
| InChI | InChI=1S/C18H23ClN2O2/c1-2-17(22)12-5-7-21(8-6-12)11-14-9-13-3-4-15(19)10-16(13)20-18(14)23/h3-4,9-10,12,17,22H,2,5-8,11H2,1H3,(H,20,23)/t17-/m1/s1 |
| InChIKey | DTLLZKZQCUBXNA-QGZVFWFLSA-N |
| XLogP | 3.16 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |