C18H22N2O3S — CID 56719378
methyl 1-[(7-methylsulfanyl-2-oxo-1H-quinolin-3-yl)methyl]piperidine-4-carboxylate (PubChem CID 56719378) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is methyl 1-[(7-methylsulfanyl-2-oxo-1H-quinolin-3-yl)methyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[(7-methylsulfanyl-2-oxo-1H-quinolin-3-yl)methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 56719378 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | methyl 1-[(7-methylsulfanyl-2-oxo-1H-quinolin-3-yl)methyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(Cc2cc3ccc(SC)cc3[nH]c2=O)CC1 |
| InChI | InChI=1S/C18H22N2O3S/c1-23-18(22)12-5-7-20(8-6-12)11-14-9-13-3-4-15(24-2)10-16(13)19-17(14)21/h3-4,9-10,12H,5-8,11H2,1-2H3,(H,19,21) |
| InChIKey | HHIGUBDIHFUBII-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |