C21H32ClFN2O4 — CID 154915712
(3aR,6aS)-5-N-[(6-chloro-2-fluoro-3-methylphenyl)methyl]-2-N,2-N,5-N-trimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine;formic acid (PubChem CID 154915712) has the molecular formula C21H32ClFN2O4 and a molecular weight of 430.95 g/mol. Its IUPAC name is (3aR,6aS)-5-N-[(6-chloro-2-fluoro-3-methylphenyl)methyl]-2-N,2-N,5-N-trimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine;formic acid.
| Compound Name | (3aR,6aS)-5-N-[(6-chloro-2-fluoro-3-methylphenyl)methyl]-2-N,2-N,5-N-trimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine;formic acid |
|---|---|
| PubChem CID | 154915712 |
| Molecular Formula | C21H32ClFN2O4 |
| Molecular Weight | 430.95 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | (3aR,6aS)-5-N-[(6-chloro-2-fluoro-3-methylphenyl)methyl]-2-N,2-N,5-N-trimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-2,5-diamine;formic acid |
| SMILES | Cc1ccc(Cl)c(CN(C)C2C[C@H]3CC(N(C)C)C[C@H]3C2)c1F.O=CO.O=CO |
| InChI | InChI=1S/C19H28ClFN2.2CH2O2/c1-12-5-6-18(20)17(19(12)21)11-23(4)16-9-13-7-15(22(2)3)8-14(13)10-16;2*2-1-3/h5-6,13-16H,7-11H2,1-4H3;2*1H,(H,2,3)/t13-,14+,15?,16?;; |
| InChIKey | SARSRFIFUVXJST-IJTOKZDFSA-N |
| XLogP | 3.74 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.95 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|