C20H27N5O4 — CID 154918510
formic acid;1-[6-[[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]amino]pyrimidin-4-yl]piperidin-4-ol (PubChem CID 154918510) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is formic acid;1-[6-[[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]amino]pyrimidin-4-yl]piperidin-4-ol.
| Compound Name | formic acid;1-[6-[[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]amino]pyrimidin-4-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 154918510 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | formic acid;1-[6-[[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]amino]pyrimidin-4-yl]piperidin-4-ol |
| SMILES | O=CO.OC1CCN(c2cc(N[C@@H]3COC[C@H]3Cc3ccncc3)ncn2)CC1 |
| InChI | InChI=1S/C19H25N5O2.CH2O2/c25-16-3-7-24(8-4-16)19-10-18(21-13-22-19)23-17-12-26-11-15(17)9-14-1-5-20-6-2-14;2-1-3/h1-2,5-6,10,13,15-17,25H,3-4,7-9,11-12H2,(H,21,22,23);1H,(H,2,3)/t15-,17-;/m1./s1 |
| InChIKey | JCNLNVGKYHHVIJ-SSPJITILSA-N |
| XLogP | 1.20 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|