C23H29N3O3 — CID 154919066
formic acid;4-[1-[4-(1H-indol-3-yl)butan-2-yl]piperidin-4-yl]-1H-pyridin-2-one (PubChem CID 154919066) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is formic acid;4-[1-[4-(1H-indol-3-yl)butan-2-yl]piperidin-4-yl]-1H-pyridin-2-one.
| Compound Name | formic acid;4-[1-[4-(1H-indol-3-yl)butan-2-yl]piperidin-4-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 154919066 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | formic acid;4-[1-[4-(1H-indol-3-yl)butan-2-yl]piperidin-4-yl]-1H-pyridin-2-one |
| SMILES | CC(CCc1c[nH]c2ccccc12)N1CCC(c2cc[nH]c(=O)c2)CC1.O=CO |
| InChI | InChI=1S/C22H27N3O.CH2O2/c1-16(6-7-19-15-24-21-5-3-2-4-20(19)21)25-12-9-17(10-13-25)18-8-11-23-22(26)14-18;2-1-3/h2-5,8,11,14-17,24H,6-7,9-10,12-13H2,1H3,(H,23,26);1H,(H,2,3) |
| InChIKey | ZMBGNSFPQAHNDR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|