C21H28N6O4 — CID 154920161
[4-[(3-ethyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]-1,4-diazepan-1-yl]-[4-(1,2,4-triazol-4-yl)phenyl]methanone;formic acid (PubChem CID 154920161) has the molecular formula C21H28N6O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is [4-[(3-ethyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]-1,4-diazepan-1-yl]-[4-(1,2,4-triazol-4-yl)phenyl]methanone;formic acid.
| Compound Name | [4-[(3-ethyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]-1,4-diazepan-1-yl]-[4-(1,2,4-triazol-4-yl)phenyl]methanone;formic acid |
|---|---|
| PubChem CID | 154920161 |
| Molecular Formula | C21H28N6O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | [4-[(3-ethyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]-1,4-diazepan-1-yl]-[4-(1,2,4-triazol-4-yl)phenyl]methanone;formic acid |
| SMILES | CCC1=NOC(CN2CCCN(C(=O)c3ccc(-n4cnnc4)cc3)CC2)C1.O=CO |
| InChI | InChI=1S/C20H26N6O2.CH2O2/c1-2-17-12-19(28-23-17)13-24-8-3-9-25(11-10-24)20(27)16-4-6-18(7-5-16)26-14-21-22-15-26;2-1-3/h4-7,14-15,19H,2-3,8-13H2,1H3;1H,(H,2,3) |
| InChIKey | WPXJIYQKYKCQEG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 113.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|