C23H26N4O4 — CID 154920241
7-[2-[4-[2-(dimethylamino)ethoxy]phenyl]imidazol-1-yl]-3,4-dihydro-2H-isoquinolin-1-one;formic acid (PubChem CID 154920241) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 7-[2-[4-[2-(dimethylamino)ethoxy]phenyl]imidazol-1-yl]-3,4-dihydro-2H-isoquinolin-1-one;formic acid.
| Compound Name | 7-[2-[4-[2-(dimethylamino)ethoxy]phenyl]imidazol-1-yl]-3,4-dihydro-2H-isoquinolin-1-one;formic acid |
|---|---|
| PubChem CID | 154920241 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 7-[2-[4-[2-(dimethylamino)ethoxy]phenyl]imidazol-1-yl]-3,4-dihydro-2H-isoquinolin-1-one;formic acid |
| SMILES | CN(C)CCOc1ccc(-c2nccn2-c2ccc3c(c2)C(=O)NCC3)cc1.O=CO |
| InChI | InChI=1S/C22H24N4O2.CH2O2/c1-25(2)13-14-28-19-7-4-17(5-8-19)21-23-11-12-26(21)18-6-3-16-9-10-24-22(27)20(16)15-18;2-1-3/h3-8,11-12,15H,9-10,13-14H2,1-2H3,(H,24,27);1H,(H,2,3) |
| InChIKey | GVJDZRYKOSZKNL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|