C27H41N3O7 — CID 154922440
(4aR,6S,8aS)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2-ethyl-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide;formic acid (PubChem CID 154922440) has the molecular formula C27H41N3O7 and a molecular weight of 519.64 g/mol. Its IUPAC name is (4aR,6S,8aS)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2-ethyl-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide;formic acid.
| Compound Name | (4aR,6S,8aS)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2-ethyl-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide;formic acid |
|---|---|
| PubChem CID | 154922440 |
| Molecular Formula | C27H41N3O7 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | (4aR,6S,8aS)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2-ethyl-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide;formic acid |
| SMILES | CCN1CC[C@@H]2C[C@@H](N3CCOCC3)CC[C@@]2(C(=O)NCc2ccc3c(c2)CCO3)C1.O=CO.O=CO |
| InChI | InChI=1S/C25H37N3O3.2CH2O2/c1-2-27-9-6-21-16-22(28-10-13-30-14-11-28)5-8-25(21,18-27)24(29)26-17-19-3-4-23-20(15-19)7-12-31-23;2*2-1-3/h3-4,15,21-22H,2,5-14,16-18H2,1H3,(H,26,29);2*1H,(H,2,3)/t21-,22+,25-;;/m1../s1 |
| InChIKey | DCHSBYXYEKHXLR-OTCWRJAQSA-N |
| XLogP | 1.85 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|