C24H35FN2O3 — CID 146046919
ethyl (4aR,6S,8aS)-2-[(3-fluoro-2-methylphenyl)methyl]-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate (PubChem CID 146046919) has the molecular formula C24H35FN2O3 and a molecular weight of 418.55 g/mol. Its IUPAC name is ethyl (4aR,6S,8aS)-2-[(3-fluoro-2-methylphenyl)methyl]-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate.
| Compound Name | ethyl (4aR,6S,8aS)-2-[(3-fluoro-2-methylphenyl)methyl]-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 146046919 |
| Molecular Formula | C24H35FN2O3 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | ethyl (4aR,6S,8aS)-2-[(3-fluoro-2-methylphenyl)methyl]-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate |
| SMILES | CCOC(=O)[C@@]12CC[C@H](N3CCOCC3)C[C@H]1CCN(Cc1cccc(F)c1C)C2 |
| InChI | InChI=1S/C24H35FN2O3/c1-3-30-23(28)24-9-7-21(27-11-13-29-14-12-27)15-20(24)8-10-26(17-24)16-19-5-4-6-22(25)18(19)2/h4-6,20-21H,3,7-17H2,1-2H3/t20-,21+,24-/m1/s1 |
| InChIKey | PPTICZGOICYVCY-ZFGGDYGUSA-N |
| XLogP | 3.39 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |