C22H32N4O3 — CID 156605828
4-[[8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]methyl]-2,1,3-benzoxadiazole (PubChem CID 156605828) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 4-[[8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]methyl]-2,1,3-benzoxadiazole.
| Compound Name | 4-[[8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]methyl]-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 156605828 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 4-[[8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]methyl]-2,1,3-benzoxadiazole |
| SMILES | COCC12CCC(N3CCOCC3)CC1CCN(Cc1cccc3nonc13)C2 |
| InChI | InChI=1S/C22H32N4O3/c1-27-16-22-7-5-19(26-9-11-28-12-10-26)13-18(22)6-8-25(15-22)14-17-3-2-4-20-21(17)24-29-23-20/h2-4,18-19H,5-16H2,1H3 |
| InChIKey | IRMKBPBRSNBVBM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |