C24H35FN2O2 — CID 91940051
4-[(4aR,6R,8aS)-2-[3-(4-fluorophenyl)prop-2-enyl]-8a-(methoxymethyl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-6-yl]morpholine (PubChem CID 91940051) has the molecular formula C24H35FN2O2 and a molecular weight of 402.55 g/mol. Its IUPAC name is 4-[(4aR,6R,8aS)-2-[3-(4-fluorophenyl)prop-2-enyl]-8a-(methoxymethyl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-6-yl]morpholine.
| Compound Name | 4-[(4aR,6R,8aS)-2-[3-(4-fluorophenyl)prop-2-enyl]-8a-(methoxymethyl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-6-yl]morpholine |
|---|---|
| PubChem CID | 91940051 |
| Molecular Formula | C24H35FN2O2 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 4-[(4aR,6R,8aS)-2-[3-(4-fluorophenyl)prop-2-enyl]-8a-(methoxymethyl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-6-yl]morpholine |
| SMILES | COC[C@@]12CC[C@@H](N3CCOCC3)C[C@H]1CCN(CC=Cc1ccc(F)cc1)C2 |
| InChI | InChI=1S/C24H35FN2O2/c1-28-19-24-10-8-23(27-13-15-29-16-14-27)17-21(24)9-12-26(18-24)11-2-3-20-4-6-22(25)7-5-20/h2-7,21,23H,8-19H2,1H3/t21-,23-,24+/m1/s1 |
| InChIKey | JTXLDCNKQFTYOR-JRFVFWCSSA-N |
| XLogP | 3.68 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |