C23H41N3O3 — CID 131948512
1-[(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-2-(azepan-1-yl)ethanone (PubChem CID 131948512) has the molecular formula C23H41N3O3 and a molecular weight of 407.60 g/mol. Its IUPAC name is 1-[(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-2-(azepan-1-yl)ethanone.
| Compound Name | 1-[(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-2-(azepan-1-yl)ethanone |
|---|---|
| PubChem CID | 131948512 |
| Molecular Formula | C23H41N3O3 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.31 |
| IUPAC Name | 1-[(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-2-(azepan-1-yl)ethanone |
| SMILES | COC[C@@]12CC[C@@H](N3CCOCC3)C[C@H]1CCN(C(=O)CN1CCCCCC1)C2 |
| InChI | InChI=1S/C23H41N3O3/c1-28-19-23-8-6-21(25-12-14-29-15-13-25)16-20(23)7-11-26(18-23)22(27)17-24-9-4-2-3-5-10-24/h20-21H,2-19H2,1H3/t20-,21-,23+/m1/s1 |
| InChIKey | NIWPKZRLSODNAC-XPNTWCBSSA-N |
| XLogP | 2.23 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |