C21H34N4O3 — CID 70710264
[(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-(2,5-dimethylpyrazol-3-yl)methanone (PubChem CID 70710264) has the molecular formula C21H34N4O3 and a molecular weight of 390.53 g/mol. Its IUPAC name is [(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-(2,5-dimethylpyrazol-3-yl)methanone.
| Compound Name | [(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-(2,5-dimethylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 70710264 |
| Molecular Formula | C21H34N4O3 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | [(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-(2,5-dimethylpyrazol-3-yl)methanone |
| SMILES | COC[C@@]12CC[C@@H](N3CCOCC3)C[C@H]1CCN(C(=O)c1cc(C)nn1C)C2 |
| InChI | InChI=1S/C21H34N4O3/c1-16-12-19(23(2)22-16)20(26)25-7-5-17-13-18(24-8-10-28-11-9-24)4-6-21(17,14-25)15-27-3/h12,17-18H,4-11,13-15H2,1-3H3/t17-,18-,21+/m1/s1 |
| InChIKey | XYDNBVUULOVTKA-OPYAIIAOSA-N |
| XLogP | 1.71 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |